C17H14ClN5OS2 — CID 87257987
[5-(3-chlorophenyl)-1,2,4-oxadiazol-3-yl]-(4-ethyl-5-thiophen-3-yl-1,2,4-triazol-3-yl)methanethiol (PubChem CID 87257987) has the molecular formula C17H14ClN5OS2 and a molecular weight of 403.92 g/mol. Its IUPAC name is [5-(3-chlorophenyl)-1,2,4-oxadiazol-3-yl]-(4-ethyl-5-thiophen-3-yl-1,2,4-triazol-3-yl)methanethiol.
| Compound Name | [5-(3-chlorophenyl)-1,2,4-oxadiazol-3-yl]-(4-ethyl-5-thiophen-3-yl-1,2,4-triazol-3-yl)methanethiol |
|---|---|
| PubChem CID | 87257987 |
| Molecular Formula | C17H14ClN5OS2 |
| Molecular Weight | 403.92 g/mol |
| Exact Mass | 403.03 |
| IUPAC Name | [5-(3-chlorophenyl)-1,2,4-oxadiazol-3-yl]-(4-ethyl-5-thiophen-3-yl-1,2,4-triazol-3-yl)methanethiol |
| SMILES | CCn1c(-c2ccsc2)nnc1C(S)c1noc(-c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C17H14ClN5OS2/c1-2-23-15(11-6-7-26-9-11)20-21-16(23)13(25)14-19-17(24-22-14)10-4-3-5-12(18)8-10/h3-9,13,25H,2H2,1H3 |
| InChIKey | FRZFPIQZSKXJGE-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 69.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.92 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|