C16H17IN2O4 — CID 174617286
6-[(2S)-2-iodo-2-morpholin-4-ylethyl]-4-oxo-1H-quinoline-3-carboxylic acid (PubChem CID 174617286) has the molecular formula C16H17IN2O4 and a molecular weight of 428.23 g/mol. Its IUPAC name is 6-[(2S)-2-iodo-2-morpholin-4-ylethyl]-4-oxo-1H-quinoline-3-carboxylic acid.
| Compound Name | 6-[(2S)-2-iodo-2-morpholin-4-ylethyl]-4-oxo-1H-quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 174617286 |
| Molecular Formula | C16H17IN2O4 |
| Molecular Weight | 428.23 g/mol |
| Exact Mass | 428.02 |
| IUPAC Name | 6-[(2S)-2-iodo-2-morpholin-4-ylethyl]-4-oxo-1H-quinoline-3-carboxylic acid |
| SMILES | O=C(O)c1c[nH]c2ccc(C[C@H](I)N3CCOCC3)cc2c1=O |
| InChI | InChI=1S/C16H17IN2O4/c17-14(19-3-5-23-6-4-19)8-10-1-2-13-11(7-10)15(20)12(9-18-13)16(21)22/h1-2,7,9,14H,3-6,8H2,(H,18,20)(H,21,22)/t14-/m1/s1 |
| InChIKey | WBZYQCGXTYJLTO-CQSZACIVSA-N |
| XLogP | 1.86 |
| TPSA | 82.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.23 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|