C22H14F2N2O3 — CID 69011082
6-[[2-fluoro-4-(2-fluoro-4-pyridinyl)phenyl]methyl]-4-oxo-1H-quinoline-3-carboxylic acid (PubChem CID 69011082) has the molecular formula C22H14F2N2O3 and a molecular weight of 392.36 g/mol. Its IUPAC name is 6-[[2-fluoro-4-(2-fluoro-4-pyridinyl)phenyl]methyl]-4-oxo-1H-quinoline-3-carboxylic acid.
| Compound Name | 6-[[2-fluoro-4-(2-fluoro-4-pyridinyl)phenyl]methyl]-4-oxo-1H-quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 69011082 |
| Molecular Formula | C22H14F2N2O3 |
| Molecular Weight | 392.36 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 6-[[2-fluoro-4-(2-fluoro-4-pyridinyl)phenyl]methyl]-4-oxo-1H-quinoline-3-carboxylic acid |
| SMILES | O=C(O)c1c[nH]c2ccc(Cc3ccc(-c4ccnc(F)c4)cc3F)cc2c1=O |
| InChI | InChI=1S/C22H14F2N2O3/c23-18-9-13(14-5-6-25-20(24)10-14)2-3-15(18)7-12-1-4-19-16(8-12)21(27)17(11-26-19)22(28)29/h1-6,8-11H,7H2,(H,26,27)(H,28,29) |
| InChIKey | WFEONVDBQKNYJP-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.36 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|