C11H16N2O2S — CID 174617515
(6-methylsulfanyl-3-pyridinyl) N-tert-butylcarbamate (PubChem CID 174617515) has the molecular formula C11H16N2O2S and a molecular weight of 240.33 g/mol. Its IUPAC name is (6-methylsulfanyl-3-pyridinyl) N-tert-butylcarbamate.
| Compound Name | (6-methylsulfanyl-3-pyridinyl) N-tert-butylcarbamate |
|---|---|
| PubChem CID | 174617515 |
| Molecular Formula | C11H16N2O2S |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | (6-methylsulfanyl-3-pyridinyl) N-tert-butylcarbamate |
| SMILES | CSc1ccc(OC(=O)NC(C)(C)C)cn1 |
| InChI | InChI=1S/C11H16N2O2S/c1-11(2,3)13-10(14)15-8-5-6-9(16-4)12-7-8/h5-7H,1-4H3,(H,13,14) |
| InChIKey | CWCRKPVJIKCOKX-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |