C20H21N7OS — CID 174618555
N-[4-[4-(diethylamino)phenyl]-1,3-thiazol-2-yl]-2-purin-7-ylacetamide (PubChem CID 174618555) has the molecular formula C20H21N7OS and a molecular weight of 407.50 g/mol. Its IUPAC name is N-[4-[4-(diethylamino)phenyl]-1,3-thiazol-2-yl]-2-purin-7-ylacetamide.
| Compound Name | N-[4-[4-(diethylamino)phenyl]-1,3-thiazol-2-yl]-2-purin-7-ylacetamide |
|---|---|
| PubChem CID | 174618555 |
| Molecular Formula | C20H21N7OS |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | N-[4-[4-(diethylamino)phenyl]-1,3-thiazol-2-yl]-2-purin-7-ylacetamide |
| SMILES | CCN(CC)c1ccc(-c2csc(NC(=O)Cn3cnc4ncncc43)n2)cc1 |
| InChI | InChI=1S/C20H21N7OS/c1-3-26(4-2)15-7-5-14(6-8-15)16-11-29-20(24-16)25-18(28)10-27-13-23-19-17(27)9-21-12-22-19/h5-9,11-13H,3-4,10H2,1-2H3,(H,24,25,28) |
| InChIKey | NXWNRTVMNJXOLZ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |