C16H11ClN6OS — CID 174603379
N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-2-purin-7-ylacetamide (PubChem CID 174603379) has the molecular formula C16H11ClN6OS and a molecular weight of 370.83 g/mol. Its IUPAC name is N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-2-purin-7-ylacetamide.
| Compound Name | N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-2-purin-7-ylacetamide |
|---|---|
| PubChem CID | 174603379 |
| Molecular Formula | C16H11ClN6OS |
| Molecular Weight | 370.83 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-2-purin-7-ylacetamide |
| SMILES | O=C(Cn1cnc2ncncc21)Nc1nc(-c2ccccc2Cl)cs1 |
| InChI | InChI=1S/C16H11ClN6OS/c17-11-4-2-1-3-10(11)12-7-25-16(21-12)22-14(24)6-23-9-20-15-13(23)5-18-8-19-15/h1-5,7-9H,6H2,(H,21,22,24) |
| InChIKey | UUHCXGOWCLBCMK-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.83 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |