C36H25Cl3N6O3S — CID 174618560
1,3-dimethyl-1,3-dihydrochrysene-2,6-dione;2-purin-7-yl-N-[4-(2,3,4-trichlorophenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 174618560) has the molecular formula C36H25Cl3N6O3S and a molecular weight of 728.06 g/mol. Its IUPAC name is 1,3-dimethyl-1,3-dihydrochrysene-2,6-dione;2-purin-7-yl-N-[4-(2,3,4-trichlorophenyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 1,3-dimethyl-1,3-dihydrochrysene-2,6-dione;2-purin-7-yl-N-[4-(2,3,4-trichlorophenyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 174618560 |
| Molecular Formula | C36H25Cl3N6O3S |
| Molecular Weight | 728.06 g/mol |
| Exact Mass | 726.08 |
| IUPAC Name | 1,3-dimethyl-1,3-dihydrochrysene-2,6-dione;2-purin-7-yl-N-[4-(2,3,4-trichlorophenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | CC1C=c2c(ccc3c2=CC(=O)c2ccccc2-3)C(C)C1=O.O=C(Cn1cnc2ncncc21)Nc1nc(-c2ccc(Cl)c(Cl)c2Cl)cs1 |
| InChI | InChI=1S/C20H16O2.C16H9Cl3N6OS/c1-11-9-17-13(12(2)20(11)22)7-8-15-14-5-3-4-6-16(14)19(21)10-18(15)17;17-9-2-1-8(13(18)14(9)19)10-5-27-16(23-10)24-12(26)4-25-7-22-15-11(25)3-20-6-21-15/h3-12H,1-2H3;1-3,5-7H,4H2,(H,23,24,26) |
| InChIKey | CYWOOHAELJHZNG-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 119.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.06 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|