C19H12Cl4N2O3S2 — CID 23738511
[2-[[4-(2-chlorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 2-(2,3,4-trichlorophenyl)sulfanylacetate (PubChem CID 23738511) has the molecular formula C19H12Cl4N2O3S2 and a molecular weight of 522.26 g/mol. Its IUPAC name is [2-[[4-(2-chlorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 2-(2,3,4-trichlorophenyl)sulfanylacetate.
| Compound Name | [2-[[4-(2-chlorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 2-(2,3,4-trichlorophenyl)sulfanylacetate |
|---|---|
| PubChem CID | 23738511 |
| Molecular Formula | C19H12Cl4N2O3S2 |
| Molecular Weight | 522.26 g/mol |
| Exact Mass | 519.90 |
| IUPAC Name | [2-[[4-(2-chlorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 2-(2,3,4-trichlorophenyl)sulfanylacetate |
| SMILES | O=C(COC(=O)CSc1ccc(Cl)c(Cl)c1Cl)Nc1nc(-c2ccccc2Cl)cs1 |
| InChI | InChI=1S/C19H12Cl4N2O3S2/c20-11-4-2-1-3-10(11)13-8-30-19(24-13)25-15(26)7-28-16(27)9-29-14-6-5-12(21)17(22)18(14)23/h1-6,8H,7,9H2,(H,24,25,26) |
| InChIKey | FMFHROBNHLMKLD-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.26 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|