C12H24N2Ru — CID 174619205
cycloocta-1,5-diene;2-methylpropane-1,2-diamine;ruthenium (PubChem CID 174619205) has the molecular formula C12H24N2Ru and a molecular weight of 297.41 g/mol. Its IUPAC name is cycloocta-1,5-diene;2-methylpropane-1,2-diamine;ruthenium.
| Compound Name | cycloocta-1,5-diene;2-methylpropane-1,2-diamine;ruthenium |
|---|---|
| PubChem CID | 174619205 |
| Molecular Formula | C12H24N2Ru |
| Molecular Weight | 297.41 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | cycloocta-1,5-diene;2-methylpropane-1,2-diamine;ruthenium |
| SMILES | C1=CCCC=CCC1.CC(C)(N)CN.[Ru] |
| InChI | InChI=1S/C8H12.C4H12N2.Ru/c1-2-4-6-8-7-5-3-1;1-4(2,6)3-5;/h1-2,7-8H,3-6H2;3,5-6H2,1-2H3; |
| InChIKey | YKFZSQGGGBAADE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.41 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|