About cycloocta-1,5-diene;2-methylpropane-1,2-diamine;ruthenium
cycloocta-1,5-diene;2-methylpropane-1,2-diamine;ruthenium (PubChem CID 174619205) has the molecular formula C12H24N2Ru
and a molecular weight of 297.41 g/mol. Its IUPAC name is cycloocta-1,5-diene;2-methylpropane-1,2-diamine;ruthenium.
Molecular Properties
| Compound Name | cycloocta-1,5-diene;2-methylpropane-1,2-diamine;ruthenium |
| PubChem CID | 174619205 |
| Molecular Formula | C12H24N2Ru |
| Molecular Weight | 297.41 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | cycloocta-1,5-diene;2-methylpropane-1,2-diamine;ruthenium |
| SMILES | C1=CCCC=CCC1.CC(C)(N)CN.[Ru] |
| InChI | InChI=1S/C8H12.C4H12N2.Ru/c1-2-4-6-8-7-5-3-1;1-4(2,6)3-5;/h1-2,7-8H,3-6H2;3,5-6H2,1-2H3; |
| InChIKey | YKFZSQGGGBAADE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.41 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cycloocta-1,5-diene;2-methylpropane-1,2-diamine;ruthenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cycloocta-1,5-diene;2-methylpropane-1,2-diamine;ruthenium?
The IUPAC name of cycloocta-1,5-diene;2-methylpropane-1,2-diamine;ruthenium (CID 174619205) is cycloocta-1,5-diene;2-methylpropane-1,2-diamine;ruthenium.
What is the SMILES notation for cycloocta-1,5-diene;2-methylpropane-1,2-diamine;ruthenium?
The canonical SMILES for cycloocta-1,5-diene;2-methylpropane-1,2-diamine;ruthenium is C1=CCCC=CCC1.CC(C)(N)CN.[Ru].
What is the InChIKey of cycloocta-1,5-diene;2-methylpropane-1,2-diamine;ruthenium?
The InChIKey is YKFZSQGGGBAADE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12.C4H12N2.Ru/c1-2-4-6-8-7-5-3-1;1-4(2,6)3-5;/h1-2,7-8H,3-6H2;3,5-6H2,1-2H3;.
What are the key properties of cycloocta-1,5-diene;2-methylpropane-1,2-diamine;ruthenium?
cycloocta-1,5-diene;2-methylpropane-1,2-diamine;ruthenium has a molecular weight of 297.41 g/mol, XLogP of 2.35, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cycloocta-1,5-diene;2-methylpropane-1,2-diamine;ruthenium is sourced from PubChem (CID 174619205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).