About 6-bromododecane;3-bromothiophene
6-bromododecane;3-bromothiophene (PubChem CID 174619505) has the molecular formula C16H28Br2S
and a molecular weight of 412.28 g/mol. Its IUPAC name is 6-bromododecane;3-bromothiophene.
Molecular Properties
| Compound Name | 6-bromododecane;3-bromothiophene |
| PubChem CID | 174619505 |
| Molecular Formula | C16H28Br2S |
| Molecular Weight | 412.28 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | 6-bromododecane;3-bromothiophene |
| SMILES | Brc1ccsc1.CCCCCCC(Br)CCCCC |
| InChI | InChI=1S/C12H25Br.C4H3BrS/c1-3-5-7-9-11-12(13)10-8-6-4-2;5-4-1-2-6-3-4/h12H,3-11H2,1-2H3;1-3H |
| InChIKey | YKRMFTPWEGKTPF-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.28 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-bromododecane;3-bromothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromododecane;3-bromothiophene?
The IUPAC name of 6-bromododecane;3-bromothiophene (CID 174619505) is 6-bromododecane;3-bromothiophene.
What is the SMILES notation for 6-bromododecane;3-bromothiophene?
The canonical SMILES for 6-bromododecane;3-bromothiophene is Brc1ccsc1.CCCCCCC(Br)CCCCC.
What is the InChIKey of 6-bromododecane;3-bromothiophene?
The InChIKey is YKRMFTPWEGKTPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25Br.C4H3BrS/c1-3-5-7-9-11-12(13)10-8-6-4-2;5-4-1-2-6-3-4/h12H,3-11H2,1-2H3;1-3H.
What are the key properties of 6-bromododecane;3-bromothiophene?
6-bromododecane;3-bromothiophene has a molecular weight of 412.28 g/mol, XLogP of 7.81, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromododecane;3-bromothiophene is sourced from PubChem (CID 174619505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).