C25H25N5O2 — CID 174620648
N-[2-(aminomethyl)-5-(5-ethyl-1H-imidazol-2-yl)phenyl]-4-(pyridin-2-ylmethoxy)benzamide (PubChem CID 174620648) has the molecular formula C25H25N5O2 and a molecular weight of 427.51 g/mol. Its IUPAC name is N-[2-(aminomethyl)-5-(5-ethyl-1H-imidazol-2-yl)phenyl]-4-(pyridin-2-ylmethoxy)benzamide.
| Compound Name | N-[2-(aminomethyl)-5-(5-ethyl-1H-imidazol-2-yl)phenyl]-4-(pyridin-2-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 174620648 |
| Molecular Formula | C25H25N5O2 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | N-[2-(aminomethyl)-5-(5-ethyl-1H-imidazol-2-yl)phenyl]-4-(pyridin-2-ylmethoxy)benzamide |
| SMILES | CCc1cnc(-c2ccc(CN)c(NC(=O)c3ccc(OCc4ccccn4)cc3)c2)[nH]1 |
| InChI | InChI=1S/C25H25N5O2/c1-2-20-15-28-24(29-20)18-6-7-19(14-26)23(13-18)30-25(31)17-8-10-22(11-9-17)32-16-21-5-3-4-12-27-21/h3-13,15H,2,14,16,26H2,1H3,(H,28,29)(H,30,31) |
| InChIKey | NQPYWDGUWSEGHK-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |