C25H22N4O3 — CID 86648378
N-[5-(5-formyl-1-methylimidazol-4-yl)-2-methylphenyl]-4-(pyridin-2-ylmethoxy)benzamide (PubChem CID 86648378) has the molecular formula C25H22N4O3 and a molecular weight of 426.48 g/mol. Its IUPAC name is N-[5-(5-formyl-1-methylimidazol-4-yl)-2-methylphenyl]-4-(pyridin-2-ylmethoxy)benzamide.
| Compound Name | N-[5-(5-formyl-1-methylimidazol-4-yl)-2-methylphenyl]-4-(pyridin-2-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 86648378 |
| Molecular Formula | C25H22N4O3 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | N-[5-(5-formyl-1-methylimidazol-4-yl)-2-methylphenyl]-4-(pyridin-2-ylmethoxy)benzamide |
| SMILES | Cc1ccc(-c2ncn(C)c2C=O)cc1NC(=O)c1ccc(OCc2ccccn2)cc1 |
| InChI | InChI=1S/C25H22N4O3/c1-17-6-7-19(24-23(14-30)29(2)16-27-24)13-22(17)28-25(31)18-8-10-21(11-9-18)32-15-20-5-3-4-12-26-20/h3-14,16H,15H2,1-2H3,(H,28,31) |
| InChIKey | XPLKIGAXPFWZCR-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|