C22H17N3O2S — CID 67379971
4-(pyridin-2-ylmethoxy)-N-[3-(1,3-thiazol-2-yl)phenyl]benzamide (PubChem CID 67379971) has the molecular formula C22H17N3O2S and a molecular weight of 387.46 g/mol. Its IUPAC name is 4-(pyridin-2-ylmethoxy)-N-[3-(1,3-thiazol-2-yl)phenyl]benzamide.
| Compound Name | 4-(pyridin-2-ylmethoxy)-N-[3-(1,3-thiazol-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 67379971 |
| Molecular Formula | C22H17N3O2S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 4-(pyridin-2-ylmethoxy)-N-[3-(1,3-thiazol-2-yl)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(-c2nccs2)c1)c1ccc(OCc2ccccn2)cc1 |
| InChI | InChI=1S/C22H17N3O2S/c26-21(25-18-6-3-4-17(14-18)22-24-12-13-28-22)16-7-9-20(10-8-16)27-15-19-5-1-2-11-23-19/h1-14H,15H2,(H,25,26) |
| InChIKey | NDKUKXSMTJQSCM-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |