C34H29N5O3 — CID 174621237
2-[2-[[3-[[3-(8-amino-3-cyclobutylimidazo[1,5-a]pyrazin-1-yl)phenoxy]methyl]phenyl]methyl]isoindol-1-yl]-2-oxoacetaldehyde (PubChem CID 174621237) has the molecular formula C34H29N5O3 and a molecular weight of 555.64 g/mol. Its IUPAC name is 2-[2-[[3-[[3-(8-amino-3-cyclobutylimidazo[1,5-a]pyrazin-1-yl)phenoxy]methyl]phenyl]methyl]isoindol-1-yl]-2-oxoacetaldehyde.
| Compound Name | 2-[2-[[3-[[3-(8-amino-3-cyclobutylimidazo[1,5-a]pyrazin-1-yl)phenoxy]methyl]phenyl]methyl]isoindol-1-yl]-2-oxoacetaldehyde |
|---|---|
| PubChem CID | 174621237 |
| Molecular Formula | C34H29N5O3 |
| Molecular Weight | 555.64 g/mol |
| Exact Mass | 555.23 |
| IUPAC Name | 2-[2-[[3-[[3-(8-amino-3-cyclobutylimidazo[1,5-a]pyrazin-1-yl)phenoxy]methyl]phenyl]methyl]isoindol-1-yl]-2-oxoacetaldehyde |
| SMILES | Nc1nccn2c(C3CCC3)nc(-c3cccc(OCc4cccc(Cn5cc6ccccc6c5C(=O)C=O)c4)c3)c12 |
| InChI | InChI=1S/C34H29N5O3/c35-33-32-30(37-34(24-9-4-10-24)39(32)15-14-36-33)25-11-5-12-27(17-25)42-21-23-7-3-6-22(16-23)18-38-19-26-8-1-2-13-28(26)31(38)29(41)20-40/h1-3,5-8,11-17,19-20,24H,4,9-10,18,21H2,(H2,35,36) |
| InChIKey | LKUQJCSPTHXOCI-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 104.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.64 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|