C14H27NO4 — CID 174621376
tert-butyl N-(3-ethyl-4-methylcyclopentyl)carbamate;formic acid (PubChem CID 174621376) has the molecular formula C14H27NO4 and a molecular weight of 273.37 g/mol. Its IUPAC name is tert-butyl N-(3-ethyl-4-methylcyclopentyl)carbamate;formic acid.
| Compound Name | tert-butyl N-(3-ethyl-4-methylcyclopentyl)carbamate;formic acid |
|---|---|
| PubChem CID | 174621376 |
| Molecular Formula | C14H27NO4 |
| Molecular Weight | 273.37 g/mol |
| Exact Mass | 273.19 |
| IUPAC Name | tert-butyl N-(3-ethyl-4-methylcyclopentyl)carbamate;formic acid |
| SMILES | CCC1CC(NC(=O)OC(C)(C)C)CC1C.O=CO |
| InChI | InChI=1S/C13H25NO2.CH2O2/c1-6-10-8-11(7-9(10)2)14-12(15)16-13(3,4)5;2-1-3/h9-11H,6-8H2,1-5H3,(H,14,15);1H,(H,2,3) |
| InChIKey | QBIYHRSWWFOMFN-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.37 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|