tert-butyl N-(3-ethyl-4-methylcyclopentyl)carbamate;formic acid

C14H27NO4 — CID 174621376

IUPACtert-butyl N-(3-ethyl-4-methylcyclopentyl)carbamate;formic acid
SMILESCCC1CC(NC(=O)OC(C)(C)C)CC1C.O=CO
InChIInChI=1S/C13H25NO2.CH2O2/c1-6-10-8-11(7-9(10)2)14-12(15)16-13(3,4)5;2-1-3/h9-11H,6-8H2,1-5H3,(H,14,15);1H,(H,2,3)
InChIKeyQBIYHRSWWFOMFN-UHFFFAOYSA-N
MW273.37 g/mol
LogP3.04
Rot. Bonds2

About tert-butyl N-(3-ethyl-4-methylcyclopentyl)carbamate;formic acid

tert-butyl N-(3-ethyl-4-methylcyclopentyl)carbamate;formic acid (PubChem CID 174621376) has the molecular formula C14H27NO4 and a molecular weight of 273.37 g/mol. Its IUPAC name is tert-butyl N-(3-ethyl-4-methylcyclopentyl)carbamate;formic acid.

Molecular Properties

Compound Nametert-butyl N-(3-ethyl-4-methylcyclopentyl)carbamate;formic acid
PubChem CID174621376
Molecular FormulaC14H27NO4
Molecular Weight273.37 g/mol
Exact Mass273.19
IUPAC Nametert-butyl N-(3-ethyl-4-methylcyclopentyl)carbamate;formic acid
SMILESCCC1CC(NC(=O)OC(C)(C)C)CC1C.O=CO
InChIInChI=1S/C13H25NO2.CH2O2/c1-6-10-8-11(7-9(10)2)14-12(15)16-13(3,4)5;2-1-3/h9-11H,6-8H2,1-5H3,(H,14,15);1H,(H,2,3)
InChIKeyQBIYHRSWWFOMFN-UHFFFAOYSA-N
XLogP3.04
TPSA75.63 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500273.37
LogP ≤ 53.04
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze tert-butyl N-(3-ethyl-4-methylcyclopentyl)carbamate;formic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of tert-butyl N-(3-ethyl-4-methylcyclopentyl)carbamate;formic acid?
The IUPAC name of tert-butyl N-(3-ethyl-4-methylcyclopentyl)carbamate;formic acid (CID 174621376) is tert-butyl N-(3-ethyl-4-methylcyclopentyl)carbamate;formic acid.
What is the SMILES notation for tert-butyl N-(3-ethyl-4-methylcyclopentyl)carbamate;formic acid?
The canonical SMILES for tert-butyl N-(3-ethyl-4-methylcyclopentyl)carbamate;formic acid is CCC1CC(NC(=O)OC(C)(C)C)CC1C.O=CO.
What is the InChIKey of tert-butyl N-(3-ethyl-4-methylcyclopentyl)carbamate;formic acid?
The InChIKey is QBIYHRSWWFOMFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO2.CH2O2/c1-6-10-8-11(7-9(10)2)14-12(15)16-13(3,4)5;2-1-3/h9-11H,6-8H2,1-5H3,(H,14,15);1H,(H,2,3).
What are the key properties of tert-butyl N-(3-ethyl-4-methylcyclopentyl)carbamate;formic acid?
tert-butyl N-(3-ethyl-4-methylcyclopentyl)carbamate;formic acid has a molecular weight of 273.37 g/mol, XLogP of 3.04, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-(3-ethyl-4-methylcyclopentyl)carbamate;formic acid is sourced from PubChem (CID 174621376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).