C27H51NO5 — CID 174622052
2-(2,2,3,3-tetramethyl-1-octoxypiperidin-4-yl)decanedioic acid (PubChem CID 174622052) has the molecular formula C27H51NO5 and a molecular weight of 469.71 g/mol. Its IUPAC name is 2-(2,2,3,3-tetramethyl-1-octoxypiperidin-4-yl)decanedioic acid.
| Compound Name | 2-(2,2,3,3-tetramethyl-1-octoxypiperidin-4-yl)decanedioic acid |
|---|---|
| PubChem CID | 174622052 |
| Molecular Formula | C27H51NO5 |
| Molecular Weight | 469.71 g/mol |
| Exact Mass | 469.38 |
| IUPAC Name | 2-(2,2,3,3-tetramethyl-1-octoxypiperidin-4-yl)decanedioic acid |
| SMILES | CCCCCCCCON1CCC(C(CCCCCCCC(=O)O)C(=O)O)C(C)(C)C1(C)C |
| InChI | InChI=1S/C27H51NO5/c1-6-7-8-9-13-16-21-33-28-20-19-23(26(2,3)27(28,4)5)22(25(31)32)17-14-11-10-12-15-18-24(29)30/h22-23H,6-21H2,1-5H3,(H,29,30)(H,31,32) |
| InChIKey | YLTVIDRQYWPWDP-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.71 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|