C38H72N2O6 — CID 175533215
10-oxo-9-(2,2,3,3-tetramethyl-1-pentoxypiperidin-4-yl)-10-(2,2,3,3-tetramethyl-1-pentoxypiperidin-4-yl)oxydecanoic acid (PubChem CID 175533215) has the molecular formula C38H72N2O6 and a molecular weight of 653.00 g/mol. Its IUPAC name is 10-oxo-9-(2,2,3,3-tetramethyl-1-pentoxypiperidin-4-yl)-10-(2,2,3,3-tetramethyl-1-pentoxypiperidin-4-yl)oxydecanoic acid.
| Compound Name | 10-oxo-9-(2,2,3,3-tetramethyl-1-pentoxypiperidin-4-yl)-10-(2,2,3,3-tetramethyl-1-pentoxypiperidin-4-yl)oxydecanoic acid |
|---|---|
| PubChem CID | 175533215 |
| Molecular Formula | C38H72N2O6 |
| Molecular Weight | 653.00 g/mol |
| Exact Mass | 652.54 |
| IUPAC Name | 10-oxo-9-(2,2,3,3-tetramethyl-1-pentoxypiperidin-4-yl)-10-(2,2,3,3-tetramethyl-1-pentoxypiperidin-4-yl)oxydecanoic acid |
| SMILES | CCCCCON1CCC(OC(=O)C(CCCCCCCC(=O)O)C2CCN(OCCCCC)C(C)(C)C2(C)C)C(C)(C)C1(C)C |
| InChI | InChI=1S/C38H72N2O6/c1-11-13-20-28-44-39-26-24-31(35(3,4)37(39,7)8)30(22-18-16-15-17-19-23-33(41)42)34(43)46-32-25-27-40(45-29-21-14-12-2)38(9,10)36(32,5)6/h30-32H,11-29H2,1-10H3,(H,41,42) |
| InChIKey | CNGPZIAEVMFEGA-UHFFFAOYSA-N |
| XLogP | 9.21 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.00 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|