C14H30N2O — CID 175412176
2,2,3,3-tetramethyl-1-pentoxypiperidin-4-amine (PubChem CID 175412176) has the molecular formula C14H30N2O and a molecular weight of 242.41 g/mol. Its IUPAC name is 2,2,3,3-tetramethyl-1-pentoxypiperidin-4-amine.
| Compound Name | 2,2,3,3-tetramethyl-1-pentoxypiperidin-4-amine |
|---|---|
| PubChem CID | 175412176 |
| Molecular Formula | C14H30N2O |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.24 |
| IUPAC Name | 2,2,3,3-tetramethyl-1-pentoxypiperidin-4-amine |
| SMILES | CCCCCON1CCC(N)C(C)(C)C1(C)C |
| InChI | InChI=1S/C14H30N2O/c1-6-7-8-11-17-16-10-9-12(15)13(2,3)14(16,4)5/h12H,6-11,15H2,1-5H3 |
| InChIKey | DWSAYPCWQAOECC-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|