About 3-hydrazinylpropanoyloxycarbonyl 3-hydrazinylpropanoate;methanamine
3-hydrazinylpropanoyloxycarbonyl 3-hydrazinylpropanoate;methanamine (PubChem CID 174622703) has the molecular formula C13H44N10O5
and a molecular weight of 420.56 g/mol. Its IUPAC name is 3-hydrazinylpropanoyloxycarbonyl 3-hydrazinylpropanoate;methanamine.
Molecular Properties
| Compound Name | 3-hydrazinylpropanoyloxycarbonyl 3-hydrazinylpropanoate;methanamine |
| PubChem CID | 174622703 |
| Molecular Formula | C13H44N10O5 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.35 |
| IUPAC Name | 3-hydrazinylpropanoyloxycarbonyl 3-hydrazinylpropanoate;methanamine |
| SMILES | CN.CN.CN.CN.CN.CN.NNCCC(=O)OC(=O)OC(=O)CCNN |
| InChI | InChI=1S/C7H14N4O5.6CH5N/c8-10-3-1-5(12)15-7(14)16-6(13)2-4-11-9;6*1-2/h10-11H,1-4,8-9H2;6*2H2,1H3 |
| InChIKey | KUWFPVFDMNVERJ-UHFFFAOYSA-N |
| XLogP | -4.65 |
| TPSA | 301.89 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | -4.65 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 15 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-hydrazinylpropanoyloxycarbonyl 3-hydrazinylpropanoate;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydrazinylpropanoyloxycarbonyl 3-hydrazinylpropanoate;methanamine?
The IUPAC name of 3-hydrazinylpropanoyloxycarbonyl 3-hydrazinylpropanoate;methanamine (CID 174622703) is 3-hydrazinylpropanoyloxycarbonyl 3-hydrazinylpropanoate;methanamine.
What is the SMILES notation for 3-hydrazinylpropanoyloxycarbonyl 3-hydrazinylpropanoate;methanamine?
The canonical SMILES for 3-hydrazinylpropanoyloxycarbonyl 3-hydrazinylpropanoate;methanamine is CN.CN.CN.CN.CN.CN.NNCCC(=O)OC(=O)OC(=O)CCNN.
What is the InChIKey of 3-hydrazinylpropanoyloxycarbonyl 3-hydrazinylpropanoate;methanamine?
The InChIKey is KUWFPVFDMNVERJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N4O5.6CH5N/c8-10-3-1-5(12)15-7(14)16-6(13)2-4-11-9;6*1-2/h10-11H,1-4,8-9H2;6*2H2,1H3.
What are the key properties of 3-hydrazinylpropanoyloxycarbonyl 3-hydrazinylpropanoate;methanamine?
3-hydrazinylpropanoyloxycarbonyl 3-hydrazinylpropanoate;methanamine has a molecular weight of 420.56 g/mol, XLogP of -4.65, 6 rotatable bonds, 10 hydrogen bond donors, and 15 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydrazinylpropanoyloxycarbonyl 3-hydrazinylpropanoate;methanamine is sourced from PubChem (CID 174622703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).