C11H10O11 — CID 175142341
5-(4-carboxy-4-oxobutanoyl)oxycarbonyloxy-2,5-dioxopentanoic acid (PubChem CID 175142341) has the molecular formula C11H10O11 and a molecular weight of 318.19 g/mol. Its IUPAC name is 5-(4-carboxy-4-oxobutanoyl)oxycarbonyloxy-2,5-dioxopentanoic acid.
| Compound Name | 5-(4-carboxy-4-oxobutanoyl)oxycarbonyloxy-2,5-dioxopentanoic acid |
|---|---|
| PubChem CID | 175142341 |
| Molecular Formula | C11H10O11 |
| Molecular Weight | 318.19 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | 5-(4-carboxy-4-oxobutanoyl)oxycarbonyloxy-2,5-dioxopentanoic acid |
| SMILES | O=C(CCC(=O)C(=O)O)OC(=O)OC(=O)CCC(=O)C(=O)O |
| InChI | InChI=1S/C11H10O11/c12-5(9(16)17)1-3-7(14)21-11(20)22-8(15)4-2-6(13)10(18)19/h1-4H2,(H,16,17)(H,18,19) |
| InChIKey | CJIYOYNFILMXTI-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 178.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.19 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|