C8H15NO — CID 174623165
N,N-dimethyl-1-(oxiran-2-yl)but-3-en-2-amine (PubChem CID 174623165) has the molecular formula C8H15NO and a molecular weight of 141.21 g/mol. Its IUPAC name is N,N-dimethyl-1-(oxiran-2-yl)but-3-en-2-amine.
| Compound Name | N,N-dimethyl-1-(oxiran-2-yl)but-3-en-2-amine |
|---|---|
| PubChem CID | 174623165 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | N,N-dimethyl-1-(oxiran-2-yl)but-3-en-2-amine |
| SMILES | C=CC(CC1CO1)N(C)C |
| InChI | InChI=1S/C8H15NO/c1-4-7(9(2)3)5-8-6-10-8/h4,7-8H,1,5-6H2,2-3H3 |
| InChIKey | ZEJMSTFPBSWNCX-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 15.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|