C17H36BrNO — CID 174053587
N,N-dimethyl-1-(oxiran-2-yl)tridecan-2-amine;hydrobromide (PubChem CID 174053587) has the molecular formula C17H36BrNO and a molecular weight of 350.39 g/mol. Its IUPAC name is N,N-dimethyl-1-(oxiran-2-yl)tridecan-2-amine;hydrobromide.
| Compound Name | N,N-dimethyl-1-(oxiran-2-yl)tridecan-2-amine;hydrobromide |
|---|---|
| PubChem CID | 174053587 |
| Molecular Formula | C17H36BrNO |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | N,N-dimethyl-1-(oxiran-2-yl)tridecan-2-amine;hydrobromide |
| SMILES | Br.CCCCCCCCCCCC(CC1CO1)N(C)C |
| InChI | InChI=1S/C17H35NO.BrH/c1-4-5-6-7-8-9-10-11-12-13-16(18(2)3)14-17-15-19-17;/h16-17H,4-15H2,1-3H3;1H |
| InChIKey | MGJMYMSRNMXDTD-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 15.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|