C17H36ClNO — CID 174764683
N,N-dimethyl-3-(oxiran-2-ylmethyl)dodecan-1-amine;hydrochloride (PubChem CID 174764683) has the molecular formula C17H36ClNO and a molecular weight of 305.93 g/mol. Its IUPAC name is N,N-dimethyl-3-(oxiran-2-ylmethyl)dodecan-1-amine;hydrochloride.
| Compound Name | N,N-dimethyl-3-(oxiran-2-ylmethyl)dodecan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 174764683 |
| Molecular Formula | C17H36ClNO |
| Molecular Weight | 305.93 g/mol |
| Exact Mass | 305.25 |
| IUPAC Name | N,N-dimethyl-3-(oxiran-2-ylmethyl)dodecan-1-amine;hydrochloride |
| SMILES | CCCCCCCCCC(CCN(C)C)CC1CO1.Cl |
| InChI | InChI=1S/C17H35NO.ClH/c1-4-5-6-7-8-9-10-11-16(12-13-18(2)3)14-17-15-19-17;/h16-17H,4-15H2,1-3H3;1H |
| InChIKey | VCZOQPPOSGQNHJ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 15.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.93 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|