C15H32BrNO — CID 173173918
N,N-dimethyl-1-(oxiran-2-yl)undecan-2-amine;hydrobromide (PubChem CID 173173918) has the molecular formula C15H32BrNO and a molecular weight of 322.33 g/mol. Its IUPAC name is N,N-dimethyl-1-(oxiran-2-yl)undecan-2-amine;hydrobromide.
| Compound Name | N,N-dimethyl-1-(oxiran-2-yl)undecan-2-amine;hydrobromide |
|---|---|
| PubChem CID | 173173918 |
| Molecular Formula | C15H32BrNO |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | N,N-dimethyl-1-(oxiran-2-yl)undecan-2-amine;hydrobromide |
| SMILES | Br.CCCCCCCCCC(CC1CO1)N(C)C |
| InChI | InChI=1S/C15H31NO.BrH/c1-4-5-6-7-8-9-10-11-14(16(2)3)12-15-13-17-15;/h14-15H,4-13H2,1-3H3;1H |
| InChIKey | AZUYGHJKERIAHS-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 15.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|