C34H39N5O3 — CID 174626756
4-[7-(4-ethylpiperazin-1-yl)-5-(4-morpholin-4-ylanilino)-4-oxo-3H-naphthalen-1-yl]-N-methylbenzamide (PubChem CID 174626756) has the molecular formula C34H39N5O3 and a molecular weight of 565.72 g/mol. Its IUPAC name is 4-[7-(4-ethylpiperazin-1-yl)-5-(4-morpholin-4-ylanilino)-4-oxo-3H-naphthalen-1-yl]-N-methylbenzamide.
| Compound Name | 4-[7-(4-ethylpiperazin-1-yl)-5-(4-morpholin-4-ylanilino)-4-oxo-3H-naphthalen-1-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 174626756 |
| Molecular Formula | C34H39N5O3 |
| Molecular Weight | 565.72 g/mol |
| Exact Mass | 565.31 |
| IUPAC Name | 4-[7-(4-ethylpiperazin-1-yl)-5-(4-morpholin-4-ylanilino)-4-oxo-3H-naphthalen-1-yl]-N-methylbenzamide |
| SMILES | CCN1CCN(c2cc(Nc3ccc(N4CCOCC4)cc3)c3c(c2)C(c2ccc(C(=O)NC)cc2)=CCC3=O)CC1 |
| InChI | InChI=1S/C34H39N5O3/c1-3-37-14-16-38(17-15-37)28-22-30-29(24-4-6-25(7-5-24)34(41)35-2)12-13-32(40)33(30)31(23-28)36-26-8-10-27(11-9-26)39-18-20-42-21-19-39/h4-12,22-23,36H,3,13-21H2,1-2H3,(H,35,41) |
| InChIKey | CXBKFGAOWARUSX-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.72 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|