C31H33F3N6O2 — CID 58094600
6-(4-ethylpiperazin-1-yl)-8-(4-morpholin-4-ylanilino)-4-[4-(trifluoromethyl)phenyl]-2H-2,7-naphthyridin-1-one (PubChem CID 58094600) has the molecular formula C31H33F3N6O2 and a molecular weight of 578.64 g/mol. Its IUPAC name is 6-(4-ethylpiperazin-1-yl)-8-(4-morpholin-4-ylanilino)-4-[4-(trifluoromethyl)phenyl]-2H-2,7-naphthyridin-1-one.
| Compound Name | 6-(4-ethylpiperazin-1-yl)-8-(4-morpholin-4-ylanilino)-4-[4-(trifluoromethyl)phenyl]-2H-2,7-naphthyridin-1-one |
|---|---|
| PubChem CID | 58094600 |
| Molecular Formula | C31H33F3N6O2 |
| Molecular Weight | 578.64 g/mol |
| Exact Mass | 578.26 |
| IUPAC Name | 6-(4-ethylpiperazin-1-yl)-8-(4-morpholin-4-ylanilino)-4-[4-(trifluoromethyl)phenyl]-2H-2,7-naphthyridin-1-one |
| SMILES | CCN1CCN(c2cc3c(-c4ccc(C(F)(F)F)cc4)c[nH]c(=O)c3c(Nc3ccc(N4CCOCC4)cc3)n2)CC1 |
| InChI | InChI=1S/C31H33F3N6O2/c1-2-38-11-13-40(14-12-38)27-19-25-26(21-3-5-22(6-4-21)31(32,33)34)20-35-30(41)28(25)29(37-27)36-23-7-9-24(10-8-23)39-15-17-42-18-16-39/h3-10,19-20H,2,11-18H2,1H3,(H,35,41)(H,36,37) |
| InChIKey | BUYQPGGFGIDNEJ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 76.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.64 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|