C22H29N7O — CID 68638905
7-(4-methylpiperazin-1-yl)-N-(4-morpholin-4-ylphenyl)-1,4-dihydropyrido[4,3-d]pyrimidin-5-amine (PubChem CID 68638905) has the molecular formula C22H29N7O and a molecular weight of 407.52 g/mol. Its IUPAC name is 7-(4-methylpiperazin-1-yl)-N-(4-morpholin-4-ylphenyl)-1,4-dihydropyrido[4,3-d]pyrimidin-5-amine.
| Compound Name | 7-(4-methylpiperazin-1-yl)-N-(4-morpholin-4-ylphenyl)-1,4-dihydropyrido[4,3-d]pyrimidin-5-amine |
|---|---|
| PubChem CID | 68638905 |
| Molecular Formula | C22H29N7O |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | 7-(4-methylpiperazin-1-yl)-N-(4-morpholin-4-ylphenyl)-1,4-dihydropyrido[4,3-d]pyrimidin-5-amine |
| SMILES | CN1CCN(c2cc3c(c(Nc4ccc(N5CCOCC5)cc4)n2)CN=CN3)CC1 |
| InChI | InChI=1S/C22H29N7O/c1-27-6-8-29(9-7-27)21-14-20-19(15-23-16-24-20)22(26-21)25-17-2-4-18(5-3-17)28-10-12-30-13-11-28/h2-5,14,16H,6-13,15H2,1H3,(H,23,24)(H,25,26) |
| InChIKey | SQLKVPHYTOAWHB-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|