C14H13Cl3N3O3S- — CID 174627708
[2-[(3-carbamoyl-5-chloro-2-imino-1-pyridinyl)methyl]-4-chlorophenyl]methanesulfinate;hydrochloride (PubChem CID 174627708) has the molecular formula C14H13Cl3N3O3S- and a molecular weight of 409.70 g/mol. Its IUPAC name is [2-[(3-carbamoyl-5-chloro-2-imino-1-pyridinyl)methyl]-4-chlorophenyl]methanesulfinate;hydrochloride.
| Compound Name | [2-[(3-carbamoyl-5-chloro-2-imino-1-pyridinyl)methyl]-4-chlorophenyl]methanesulfinate;hydrochloride |
|---|---|
| PubChem CID | 174627708 |
| Molecular Formula | C14H13Cl3N3O3S- |
| Molecular Weight | 409.70 g/mol |
| Exact Mass | 407.97 |
| IUPAC Name | [2-[(3-carbamoyl-5-chloro-2-imino-1-pyridinyl)methyl]-4-chlorophenyl]methanesulfinate;hydrochloride |
| SMILES | Cl.[H]/N=c1/c(C(N)=O)cc(Cl)cn1Cc1cc(Cl)ccc1CS(=O)[O-] |
| InChI | InChI=1S/C14H13Cl2N3O3S.ClH/c15-10-2-1-8(7-23(21)22)9(3-10)5-19-6-11(16)4-12(13(19)17)14(18)20;/h1-4,6,17H,5,7H2,(H2,18,20)(H,21,22);1H/p-1/b17-13-; |
| InChIKey | YJPUVNSKQIUOAC-VSORCOHTSA-M |
| XLogP | 2.22 |
| TPSA | 112.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.70 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|