C13H12Cl2N4O — CID 89111989
1-[(2-amino-4-chlorophenyl)methyl]-5-chloro-2-iminopyridine-3-carboxamide (PubChem CID 89111989) has the molecular formula C13H12Cl2N4O and a molecular weight of 311.17 g/mol. Its IUPAC name is 1-[(2-amino-4-chlorophenyl)methyl]-5-chloro-2-iminopyridine-3-carboxamide.
| Compound Name | 1-[(2-amino-4-chlorophenyl)methyl]-5-chloro-2-iminopyridine-3-carboxamide |
|---|---|
| PubChem CID | 89111989 |
| Molecular Formula | C13H12Cl2N4O |
| Molecular Weight | 311.17 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 1-[(2-amino-4-chlorophenyl)methyl]-5-chloro-2-iminopyridine-3-carboxamide |
| SMILES | [H]/N=c1/c(C(N)=O)cc(Cl)cn1Cc1ccc(Cl)cc1N |
| InChI | InChI=1S/C13H12Cl2N4O/c14-8-2-1-7(11(16)4-8)5-19-6-9(15)3-10(12(19)17)13(18)20/h1-4,6,17H,5,16H2,(H2,18,20)/b17-12- |
| InChIKey | PTQNMQNDUVLPFM-ATVHPVEESA-N |
| XLogP | 2.00 |
| TPSA | 97.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.17 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|