C14H15BrClN3O — CID 68662047
5-chloro-2-imino-1-[(3-methylphenyl)methyl]pyridine-3-carboxamide;hydrobromide (PubChem CID 68662047) has the molecular formula C14H15BrClN3O and a molecular weight of 356.65 g/mol. Its IUPAC name is 5-chloro-2-imino-1-[(3-methylphenyl)methyl]pyridine-3-carboxamide;hydrobromide.
| Compound Name | 5-chloro-2-imino-1-[(3-methylphenyl)methyl]pyridine-3-carboxamide;hydrobromide |
|---|---|
| PubChem CID | 68662047 |
| Molecular Formula | C14H15BrClN3O |
| Molecular Weight | 356.65 g/mol |
| Exact Mass | 355.01 |
| IUPAC Name | 5-chloro-2-imino-1-[(3-methylphenyl)methyl]pyridine-3-carboxamide;hydrobromide |
| SMILES | Br.[H]/N=c1/c(C(N)=O)cc(Cl)cn1Cc1cccc(C)c1 |
| InChI | InChI=1S/C14H14ClN3O.BrH/c1-9-3-2-4-10(5-9)7-18-8-11(15)6-12(13(18)16)14(17)19;/h2-6,8,16H,7H2,1H3,(H2,17,19);1H/b16-13-; |
| InChIKey | BWQXZRPDMKSPDF-UNVLYCKESA-N |
| XLogP | 2.65 |
| TPSA | 71.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.65 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |