C15H17N3O3 — CID 174627764
1-(2-amino-4-methyl-6-oxo-1H-pyrimidin-5-yl)propan-2-yl benzoate (PubChem CID 174627764) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is 1-(2-amino-4-methyl-6-oxo-1H-pyrimidin-5-yl)propan-2-yl benzoate.
| Compound Name | 1-(2-amino-4-methyl-6-oxo-1H-pyrimidin-5-yl)propan-2-yl benzoate |
|---|---|
| PubChem CID | 174627764 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 1-(2-amino-4-methyl-6-oxo-1H-pyrimidin-5-yl)propan-2-yl benzoate |
| SMILES | Cc1nc(N)[nH]c(=O)c1CC(C)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C15H17N3O3/c1-9(21-14(20)11-6-4-3-5-7-11)8-12-10(2)17-15(16)18-13(12)19/h3-7,9H,8H2,1-2H3,(H3,16,17,18,19) |
| InChIKey | BXPJNTKPYCKIBI-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |