C16H22N2O2 — CID 174627833
tert-butyl formate;2-(1,2,3,4-tetrahydroisoquinolin-6-yl)acetonitrile (PubChem CID 174627833) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is tert-butyl formate;2-(1,2,3,4-tetrahydroisoquinolin-6-yl)acetonitrile.
| Compound Name | tert-butyl formate;2-(1,2,3,4-tetrahydroisoquinolin-6-yl)acetonitrile |
|---|---|
| PubChem CID | 174627833 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | tert-butyl formate;2-(1,2,3,4-tetrahydroisoquinolin-6-yl)acetonitrile |
| SMILES | CC(C)(C)OC=O.N#CCc1ccc2c(c1)CCNC2 |
| InChI | InChI=1S/C11H12N2.C5H10O2/c12-5-3-9-1-2-11-8-13-6-4-10(11)7-9;1-5(2,3)7-4-6/h1-2,7,13H,3-4,6,8H2;4H,1-3H3 |
| InChIKey | OYXFRTMWKQQBDS-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|