C31H40N4O3 — CID 174627843
tert-butyl formate;5-[4-[(4-methyl-5-phenylmethoxypyrimidin-2-yl)methyl]piperidin-1-yl]-2,3-dihydro-1H-indole (PubChem CID 174627843) has the molecular formula C31H40N4O3 and a molecular weight of 516.69 g/mol. Its IUPAC name is tert-butyl formate;5-[4-[(4-methyl-5-phenylmethoxypyrimidin-2-yl)methyl]piperidin-1-yl]-2,3-dihydro-1H-indole.
| Compound Name | tert-butyl formate;5-[4-[(4-methyl-5-phenylmethoxypyrimidin-2-yl)methyl]piperidin-1-yl]-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 174627843 |
| Molecular Formula | C31H40N4O3 |
| Molecular Weight | 516.69 g/mol |
| Exact Mass | 516.31 |
| IUPAC Name | tert-butyl formate;5-[4-[(4-methyl-5-phenylmethoxypyrimidin-2-yl)methyl]piperidin-1-yl]-2,3-dihydro-1H-indole |
| SMILES | CC(C)(C)OC=O.Cc1nc(CC2CCN(c3ccc4c(c3)CCN4)CC2)ncc1OCc1ccccc1 |
| InChI | InChI=1S/C26H30N4O.C5H10O2/c1-19-25(31-18-21-5-3-2-4-6-21)17-28-26(29-19)15-20-10-13-30(14-11-20)23-7-8-24-22(16-23)9-12-27-24;1-5(2,3)7-4-6/h2-8,16-17,20,27H,9-15,18H2,1H3;4H,1-3H3 |
| InChIKey | GPVJPWLEFIEVNN-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.69 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|