C28H41N3O6 — CID 174627883
tert-butyl formate;tert-butyl 4-[2-(6-oxo-5-phenylmethoxy-1H-pyrimidin-2-yl)ethyl]piperidine-1-carboxylate (PubChem CID 174627883) has the molecular formula C28H41N3O6 and a molecular weight of 515.65 g/mol. Its IUPAC name is tert-butyl formate;tert-butyl 4-[2-(6-oxo-5-phenylmethoxy-1H-pyrimidin-2-yl)ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl formate;tert-butyl 4-[2-(6-oxo-5-phenylmethoxy-1H-pyrimidin-2-yl)ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 174627883 |
| Molecular Formula | C28H41N3O6 |
| Molecular Weight | 515.65 g/mol |
| Exact Mass | 515.30 |
| IUPAC Name | tert-butyl formate;tert-butyl 4-[2-(6-oxo-5-phenylmethoxy-1H-pyrimidin-2-yl)ethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CCc2ncc(OCc3ccccc3)c(=O)[nH]2)CC1.CC(C)(C)OC=O |
| InChI | InChI=1S/C23H31N3O4.C5H10O2/c1-23(2,3)30-22(28)26-13-11-17(12-14-26)9-10-20-24-15-19(21(27)25-20)29-16-18-7-5-4-6-8-18;1-5(2,3)7-4-6/h4-8,15,17H,9-14,16H2,1-3H3,(H,24,25,27);4H,1-3H3 |
| InChIKey | FDAPMGVGSALDFA-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 110.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.65 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|