C19H25ClN2O5 — CID 174613485
tert-butyl formate;2-(chloromethyl)-4-(methoxymethoxy)-5-phenylmethoxypyrimidine (PubChem CID 174613485) has the molecular formula C19H25ClN2O5 and a molecular weight of 396.87 g/mol. Its IUPAC name is tert-butyl formate;2-(chloromethyl)-4-(methoxymethoxy)-5-phenylmethoxypyrimidine.
| Compound Name | tert-butyl formate;2-(chloromethyl)-4-(methoxymethoxy)-5-phenylmethoxypyrimidine |
|---|---|
| PubChem CID | 174613485 |
| Molecular Formula | C19H25ClN2O5 |
| Molecular Weight | 396.87 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | tert-butyl formate;2-(chloromethyl)-4-(methoxymethoxy)-5-phenylmethoxypyrimidine |
| SMILES | CC(C)(C)OC=O.COCOc1nc(CCl)ncc1OCc1ccccc1 |
| InChI | InChI=1S/C14H15ClN2O3.C5H10O2/c1-18-10-20-14-12(8-16-13(7-15)17-14)19-9-11-5-3-2-4-6-11;1-5(2,3)7-4-6/h2-6,8H,7,9-10H2,1H3;4H,1-3H3 |
| InChIKey | VUUPEBGZHHIQDR-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 79.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.87 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|