C32H37N3O4 — CID 174627825
tert-butyl formate;2-[[6-(4-tert-butylphenyl)-3-pyridinyl]methyl]-5-phenylmethoxy-1H-pyrimidin-6-one (PubChem CID 174627825) has the molecular formula C32H37N3O4 and a molecular weight of 527.67 g/mol. Its IUPAC name is tert-butyl formate;2-[[6-(4-tert-butylphenyl)-3-pyridinyl]methyl]-5-phenylmethoxy-1H-pyrimidin-6-one.
| Compound Name | tert-butyl formate;2-[[6-(4-tert-butylphenyl)-3-pyridinyl]methyl]-5-phenylmethoxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 174627825 |
| Molecular Formula | C32H37N3O4 |
| Molecular Weight | 527.67 g/mol |
| Exact Mass | 527.28 |
| IUPAC Name | tert-butyl formate;2-[[6-(4-tert-butylphenyl)-3-pyridinyl]methyl]-5-phenylmethoxy-1H-pyrimidin-6-one |
| SMILES | CC(C)(C)OC=O.CC(C)(C)c1ccc(-c2ccc(Cc3ncc(OCc4ccccc4)c(=O)[nH]3)cn2)cc1 |
| InChI | InChI=1S/C27H27N3O2.C5H10O2/c1-27(2,3)22-12-10-21(11-13-22)23-14-9-20(16-28-23)15-25-29-17-24(26(31)30-25)32-18-19-7-5-4-6-8-19;1-5(2,3)7-4-6/h4-14,16-17H,15,18H2,1-3H3,(H,29,30,31);4H,1-3H3 |
| InChIKey | ZIBOPKHHBIPGAC-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.67 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|