C17H21BrClNO3 — CID 174628236
5-bromo-4-chloro-3-(3-hydroxyindol-3-yl)nonanoic acid (PubChem CID 174628236) has the molecular formula C17H21BrClNO3 and a molecular weight of 402.72 g/mol. Its IUPAC name is 5-bromo-4-chloro-3-(3-hydroxyindol-3-yl)nonanoic acid.
| Compound Name | 5-bromo-4-chloro-3-(3-hydroxyindol-3-yl)nonanoic acid |
|---|---|
| PubChem CID | 174628236 |
| Molecular Formula | C17H21BrClNO3 |
| Molecular Weight | 402.72 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | 5-bromo-4-chloro-3-(3-hydroxyindol-3-yl)nonanoic acid |
| SMILES | CCCCC(Br)C(Cl)C(CC(=O)O)C1(O)C=Nc2ccccc21 |
| InChI | InChI=1S/C17H21BrClNO3/c1-2-3-7-13(18)16(19)12(9-15(21)22)17(23)10-20-14-8-5-4-6-11(14)17/h4-6,8,10,12-13,16,23H,2-3,7,9H2,1H3,(H,21,22) |
| InChIKey | CTCDSFZKUARCFJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.72 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|