C28H29NO3 — CID 174632668
2-[(3-benzoylphenyl)methyl]-2-morpholin-2-yl-1-phenylbutan-1-one (PubChem CID 174632668) has the molecular formula C28H29NO3 and a molecular weight of 427.54 g/mol. Its IUPAC name is 2-[(3-benzoylphenyl)methyl]-2-morpholin-2-yl-1-phenylbutan-1-one.
| Compound Name | 2-[(3-benzoylphenyl)methyl]-2-morpholin-2-yl-1-phenylbutan-1-one |
|---|---|
| PubChem CID | 174632668 |
| Molecular Formula | C28H29NO3 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | 2-[(3-benzoylphenyl)methyl]-2-morpholin-2-yl-1-phenylbutan-1-one |
| SMILES | CCC(Cc1cccc(C(=O)c2ccccc2)c1)(C(=O)c1ccccc1)C1CNCCO1 |
| InChI | InChI=1S/C28H29NO3/c1-2-28(25-20-29-16-17-32-25,27(31)23-13-7-4-8-14-23)19-21-10-9-15-24(18-21)26(30)22-11-5-3-6-12-22/h3-15,18,25,29H,2,16-17,19-20H2,1H3 |
| InChIKey | DSXVTXSUUBYIJE-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |