C23H30N2O4 — CID 174772585
2-benzyl-2-(dimethoxyamino)-1-(4-morpholin-2-ylphenyl)butan-1-one (PubChem CID 174772585) has the molecular formula C23H30N2O4 and a molecular weight of 398.50 g/mol. Its IUPAC name is 2-benzyl-2-(dimethoxyamino)-1-(4-morpholin-2-ylphenyl)butan-1-one.
| Compound Name | 2-benzyl-2-(dimethoxyamino)-1-(4-morpholin-2-ylphenyl)butan-1-one |
|---|---|
| PubChem CID | 174772585 |
| Molecular Formula | C23H30N2O4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 2-benzyl-2-(dimethoxyamino)-1-(4-morpholin-2-ylphenyl)butan-1-one |
| SMILES | CCC(Cc1ccccc1)(C(=O)c1ccc(C2CNCCO2)cc1)N(OC)OC |
| InChI | InChI=1S/C23H30N2O4/c1-4-23(25(27-2)28-3,16-18-8-6-5-7-9-18)22(26)20-12-10-19(11-13-20)21-17-24-14-15-29-21/h5-13,21,24H,4,14-17H2,1-3H3 |
| InChIKey | AIMXYMSHQOVMKP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|