C23H32N2O — CID 174876057
N,N-dimethyl-2-(4-morpholin-2-ylphenyl)-1-phenylpentan-3-amine (PubChem CID 174876057) has the molecular formula C23H32N2O and a molecular weight of 352.52 g/mol. Its IUPAC name is N,N-dimethyl-2-(4-morpholin-2-ylphenyl)-1-phenylpentan-3-amine.
| Compound Name | N,N-dimethyl-2-(4-morpholin-2-ylphenyl)-1-phenylpentan-3-amine |
|---|---|
| PubChem CID | 174876057 |
| Molecular Formula | C23H32N2O |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.25 |
| IUPAC Name | N,N-dimethyl-2-(4-morpholin-2-ylphenyl)-1-phenylpentan-3-amine |
| SMILES | CCC(C(Cc1ccccc1)c1ccc(C2CNCCO2)cc1)N(C)C |
| InChI | InChI=1S/C23H32N2O/c1-4-22(25(2)3)21(16-18-8-6-5-7-9-18)19-10-12-20(13-11-19)23-17-24-14-15-26-23/h5-13,21-24H,4,14-17H2,1-3H3 |
| InChIKey | CITRSXMUEAZBNZ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |