C14H17ClF5NO2 — CID 57341574
(2R)-3,3,4,4,4-pentafluoro-2-[(2S)-morpholin-2-yl]-1-phenylbutan-2-ol;hydrochloride (PubChem CID 57341574) has the molecular formula C14H17ClF5NO2 and a molecular weight of 361.74 g/mol. Its IUPAC name is (2R)-3,3,4,4,4-pentafluoro-2-[(2S)-morpholin-2-yl]-1-phenylbutan-2-ol;hydrochloride.
| Compound Name | (2R)-3,3,4,4,4-pentafluoro-2-[(2S)-morpholin-2-yl]-1-phenylbutan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 57341574 |
| Molecular Formula | C14H17ClF5NO2 |
| Molecular Weight | 361.74 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | (2R)-3,3,4,4,4-pentafluoro-2-[(2S)-morpholin-2-yl]-1-phenylbutan-2-ol;hydrochloride |
| SMILES | Cl.O[C@](Cc1ccccc1)([C@@H]1CNCCO1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H16F5NO2.ClH/c15-13(16,14(17,18)19)12(21,11-9-20-6-7-22-11)8-10-4-2-1-3-5-10;/h1-5,11,20-21H,6-9H2;1H/t11-,12+;/m0./s1 |
| InChIKey | AYBZPBIVFAWCJZ-ZVWHLABXSA-N |
| XLogP | 2.57 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.74 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|