C20H23F3INO3 — CID 158449905
iodomethane;(1R)-1-[(2R)-morpholin-2-yl]-1-phenyl-2-[2-(trifluoromethoxy)phenyl]ethanol (PubChem CID 158449905) has the molecular formula C20H23F3INO3 and a molecular weight of 509.31 g/mol. Its IUPAC name is iodomethane;(1R)-1-[(2R)-morpholin-2-yl]-1-phenyl-2-[2-(trifluoromethoxy)phenyl]ethanol.
| Compound Name | iodomethane;(1R)-1-[(2R)-morpholin-2-yl]-1-phenyl-2-[2-(trifluoromethoxy)phenyl]ethanol |
|---|---|
| PubChem CID | 158449905 |
| Molecular Formula | C20H23F3INO3 |
| Molecular Weight | 509.31 g/mol |
| Exact Mass | 509.07 |
| IUPAC Name | iodomethane;(1R)-1-[(2R)-morpholin-2-yl]-1-phenyl-2-[2-(trifluoromethoxy)phenyl]ethanol |
| SMILES | CI.O[C@](Cc1ccccc1OC(F)(F)F)(c1ccccc1)[C@H]1CNCCO1 |
| InChI | InChI=1S/C19H20F3NO3.CH3I/c20-19(21,22)26-16-9-5-4-6-14(16)12-18(24,15-7-2-1-3-8-15)17-13-23-10-11-25-17;1-2/h1-9,17,23-24H,10-13H2;1H3/t17-,18-;/m1./s1 |
| InChIKey | HDVTVRYIUGPZJK-JAXOOIEVSA-N |
| XLogP | 4.06 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.31 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|