About (1R)-2-(4,4-difluorocyclohexyl)-1-[(2S)-morpholin-2-yl]-1-phenylethanol
(1R)-2-(4,4-difluorocyclohexyl)-1-[(2S)-morpholin-2-yl]-1-phenylethanol (PubChem CID 57341754) has the molecular formula C18H25F2NO2
and a molecular weight of 325.40 g/mol. Its IUPAC name is (1R)-2-(4,4-difluorocyclohexyl)-1-[(2S)-morpholin-2-yl]-1-phenylethanol.
Molecular Properties
| Compound Name | (1R)-2-(4,4-difluorocyclohexyl)-1-[(2S)-morpholin-2-yl]-1-phenylethanol |
| PubChem CID | 57341754 |
| Molecular Formula | C18H25F2NO2 |
| Molecular Weight | 325.40 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | (1R)-2-(4,4-difluorocyclohexyl)-1-[(2S)-morpholin-2-yl]-1-phenylethanol |
| SMILES | O[C@](CC1CCC(F)(F)CC1)(c1ccccc1)[C@@H]1CNCCO1 |
| InChI | InChI=1S/C18H25F2NO2/c19-17(20)8-6-14(7-9-17)12-18(22,15-4-2-1-3-5-15)16-13-21-10-11-23-16/h1-5,14,16,21-22H,6-13H2/t16-,18+/m0/s1 |
| InChIKey | JGDXYUIOGBDOTQ-FUHWJXTLSA-N |
| XLogP | 3.08 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1R)-2-(4,4-difluorocyclohexyl)-1-[(2S)-morpholin-2-yl]-1-phenylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-2-(4,4-difluorocyclohexyl)-1-[(2S)-morpholin-2-yl]-1-phenylethanol?
The IUPAC name of (1R)-2-(4,4-difluorocyclohexyl)-1-[(2S)-morpholin-2-yl]-1-phenylethanol (CID 57341754) is (1R)-2-(4,4-difluorocyclohexyl)-1-[(2S)-morpholin-2-yl]-1-phenylethanol.
What is the SMILES notation for (1R)-2-(4,4-difluorocyclohexyl)-1-[(2S)-morpholin-2-yl]-1-phenylethanol?
The canonical SMILES for (1R)-2-(4,4-difluorocyclohexyl)-1-[(2S)-morpholin-2-yl]-1-phenylethanol is O[C@](CC1CCC(F)(F)CC1)(c1ccccc1)[C@@H]1CNCCO1.
What is the InChIKey of (1R)-2-(4,4-difluorocyclohexyl)-1-[(2S)-morpholin-2-yl]-1-phenylethanol?
The InChIKey is JGDXYUIOGBDOTQ-FUHWJXTLSA-N. The full InChI is InChI=1S/C18H25F2NO2/c19-17(20)8-6-14(7-9-17)12-18(22,15-4-2-1-3-5-15)16-13-21-10-11-23-16/h1-5,14,16,21-22H,6-13H2/t16-,18+/m0/s1.
What are the key properties of (1R)-2-(4,4-difluorocyclohexyl)-1-[(2S)-morpholin-2-yl]-1-phenylethanol?
(1R)-2-(4,4-difluorocyclohexyl)-1-[(2S)-morpholin-2-yl]-1-phenylethanol has a molecular weight of 325.40 g/mol, XLogP of 3.08, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-2-(4,4-difluorocyclohexyl)-1-[(2S)-morpholin-2-yl]-1-phenylethanol is sourced from PubChem (CID 57341754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).