C20H25NO4 — CID 159038319
(1R)-2-(2,5-dimethoxyphenyl)-1-[(2R)-morpholin-2-yl]-1-phenylethanol (PubChem CID 159038319) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is (1R)-2-(2,5-dimethoxyphenyl)-1-[(2R)-morpholin-2-yl]-1-phenylethanol.
| Compound Name | (1R)-2-(2,5-dimethoxyphenyl)-1-[(2R)-morpholin-2-yl]-1-phenylethanol |
|---|---|
| PubChem CID | 159038319 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | (1R)-2-(2,5-dimethoxyphenyl)-1-[(2R)-morpholin-2-yl]-1-phenylethanol |
| SMILES | COc1ccc(OC)c(C[C@@](O)(c2ccccc2)[C@H]2CNCCO2)c1 |
| InChI | InChI=1S/C20H25NO4/c1-23-17-8-9-18(24-2)15(12-17)13-20(22,16-6-4-3-5-7-16)19-14-21-10-11-25-19/h3-9,12,19,21-22H,10-11,13-14H2,1-2H3/t19-,20-/m1/s1 |
| InChIKey | MNXJARQXVSJOQR-WOJBJXKFSA-N |
| XLogP | 2.12 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |