C27H31NO4 — CID 143010879
1-[(2S)-4-benzylmorpholin-2-yl]-2-(2,5-dimethoxyphenyl)-1-phenylethanol (PubChem CID 143010879) has the molecular formula C27H31NO4 and a molecular weight of 433.55 g/mol. Its IUPAC name is 1-[(2S)-4-benzylmorpholin-2-yl]-2-(2,5-dimethoxyphenyl)-1-phenylethanol.
| Compound Name | 1-[(2S)-4-benzylmorpholin-2-yl]-2-(2,5-dimethoxyphenyl)-1-phenylethanol |
|---|---|
| PubChem CID | 143010879 |
| Molecular Formula | C27H31NO4 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | 1-[(2S)-4-benzylmorpholin-2-yl]-2-(2,5-dimethoxyphenyl)-1-phenylethanol |
| SMILES | COc1ccc(OC)c(CC(O)(c2ccccc2)[C@@H]2CN(Cc3ccccc3)CCO2)c1 |
| InChI | InChI=1S/C27H31NO4/c1-30-24-13-14-25(31-2)22(17-24)18-27(29,23-11-7-4-8-12-23)26-20-28(15-16-32-26)19-21-9-5-3-6-10-21/h3-14,17,26,29H,15-16,18-20H2,1-2H3/t26-,27?/m0/s1 |
| InChIKey | JMOOOMDLNFXEBB-QBHOUYDASA-N |
| XLogP | 4.04 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |