C23H30FNO3 — CID 59789302
2-(4-benzylmorpholin-2-yl)-1-(5-fluoro-2-methoxyphenyl)-3-methylbutan-2-ol (PubChem CID 59789302) has the molecular formula C23H30FNO3 and a molecular weight of 387.50 g/mol. Its IUPAC name is 2-(4-benzylmorpholin-2-yl)-1-(5-fluoro-2-methoxyphenyl)-3-methylbutan-2-ol.
| Compound Name | 2-(4-benzylmorpholin-2-yl)-1-(5-fluoro-2-methoxyphenyl)-3-methylbutan-2-ol |
|---|---|
| PubChem CID | 59789302 |
| Molecular Formula | C23H30FNO3 |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | 2-(4-benzylmorpholin-2-yl)-1-(5-fluoro-2-methoxyphenyl)-3-methylbutan-2-ol |
| SMILES | COc1ccc(F)cc1CC(O)(C(C)C)C1CN(Cc2ccccc2)CCO1 |
| InChI | InChI=1S/C23H30FNO3/c1-17(2)23(26,14-19-13-20(24)9-10-21(19)27-3)22-16-25(11-12-28-22)15-18-7-5-4-6-8-18/h4-10,13,17,22,26H,11-12,14-16H2,1-3H3 |
| InChIKey | QFYJYWIJJNXAQV-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |