C26H26F3NO3 — CID 69292293
1-(4-benzylmorpholin-2-yl)-1-phenyl-2-[2-(trifluoromethoxy)phenyl]ethanol (PubChem CID 69292293) has the molecular formula C26H26F3NO3 and a molecular weight of 457.49 g/mol. Its IUPAC name is 1-(4-benzylmorpholin-2-yl)-1-phenyl-2-[2-(trifluoromethoxy)phenyl]ethanol.
| Compound Name | 1-(4-benzylmorpholin-2-yl)-1-phenyl-2-[2-(trifluoromethoxy)phenyl]ethanol |
|---|---|
| PubChem CID | 69292293 |
| Molecular Formula | C26H26F3NO3 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | 1-(4-benzylmorpholin-2-yl)-1-phenyl-2-[2-(trifluoromethoxy)phenyl]ethanol |
| SMILES | OC(Cc1ccccc1OC(F)(F)F)(c1ccccc1)C1CN(Cc2ccccc2)CCO1 |
| InChI | InChI=1S/C26H26F3NO3/c27-26(28,29)33-23-14-8-7-11-21(23)17-25(31,22-12-5-2-6-13-22)24-19-30(15-16-32-24)18-20-9-3-1-4-10-20/h1-14,24,31H,15-19H2 |
| InChIKey | RWMNZSMOBIYZCE-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |