C30H28FNO2 — CID 70335752
[(2S)-4-benzylmorpholin-2-yl]-(5-fluoro-2-phenylphenyl)-phenylmethanol (PubChem CID 70335752) has the molecular formula C30H28FNO2 and a molecular weight of 453.56 g/mol. Its IUPAC name is [(2S)-4-benzylmorpholin-2-yl]-(5-fluoro-2-phenylphenyl)-phenylmethanol.
| Compound Name | [(2S)-4-benzylmorpholin-2-yl]-(5-fluoro-2-phenylphenyl)-phenylmethanol |
|---|---|
| PubChem CID | 70335752 |
| Molecular Formula | C30H28FNO2 |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | [(2S)-4-benzylmorpholin-2-yl]-(5-fluoro-2-phenylphenyl)-phenylmethanol |
| SMILES | OC(c1ccccc1)(c1cc(F)ccc1-c1ccccc1)[C@@H]1CN(Cc2ccccc2)CCO1 |
| InChI | InChI=1S/C30H28FNO2/c31-26-16-17-27(24-12-6-2-7-13-24)28(20-26)30(33,25-14-8-3-9-15-25)29-22-32(18-19-34-29)21-23-10-4-1-5-11-23/h1-17,20,29,33H,18-19,21-22H2/t29-,30?/m0/s1 |
| InChIKey | NCZWNKHEUMKXMT-UFXYQILXSA-N |
| XLogP | 5.63 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |