C26H28FNO2 — CID 70335932
(2R)-4-benzyl-2-[2-(5-fluoro-2-methoxyphenyl)-1-phenylethyl]morpholine (PubChem CID 70335932) has the molecular formula C26H28FNO2 and a molecular weight of 405.51 g/mol. Its IUPAC name is (2R)-4-benzyl-2-[2-(5-fluoro-2-methoxyphenyl)-1-phenylethyl]morpholine.
| Compound Name | (2R)-4-benzyl-2-[2-(5-fluoro-2-methoxyphenyl)-1-phenylethyl]morpholine |
|---|---|
| PubChem CID | 70335932 |
| Molecular Formula | C26H28FNO2 |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | (2R)-4-benzyl-2-[2-(5-fluoro-2-methoxyphenyl)-1-phenylethyl]morpholine |
| SMILES | COc1ccc(F)cc1CC(c1ccccc1)[C@@H]1CN(Cc2ccccc2)CCO1 |
| InChI | InChI=1S/C26H28FNO2/c1-29-25-13-12-23(27)16-22(25)17-24(21-10-6-3-7-11-21)26-19-28(14-15-30-26)18-20-8-4-2-5-9-20/h2-13,16,24,26H,14-15,17-19H2,1H3/t24?,26-/m0/s1 |
| InChIKey | AXQVFLPOKWOGTR-JKGBFCRXSA-N |
| XLogP | 5.06 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |