C20H25NO3 — CID 69291601
(1S)-2-(2-ethoxyphenyl)-1-[(2R)-morpholin-2-yl]-1-phenylethanol (PubChem CID 69291601) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is (1S)-2-(2-ethoxyphenyl)-1-[(2R)-morpholin-2-yl]-1-phenylethanol.
| Compound Name | (1S)-2-(2-ethoxyphenyl)-1-[(2R)-morpholin-2-yl]-1-phenylethanol |
|---|---|
| PubChem CID | 69291601 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | (1S)-2-(2-ethoxyphenyl)-1-[(2R)-morpholin-2-yl]-1-phenylethanol |
| SMILES | CCOc1ccccc1C[C@](O)(c1ccccc1)[C@H]1CNCCO1 |
| InChI | InChI=1S/C20H25NO3/c1-2-23-18-11-7-6-8-16(18)14-20(22,17-9-4-3-5-10-17)19-15-21-12-13-24-19/h3-11,19,21-22H,2,12-15H2,1H3/t19-,20+/m1/s1 |
| InChIKey | SJKATDZDYZMMAP-UXHICEINSA-N |
| XLogP | 2.50 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |